C23H28F3N3O4S — CID 100562420
(2R)-N-butyl-2-[[2-(3,4-difluoro-N-methylsulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide (PubChem CID 100562420) has the molecular formula C23H28F3N3O4S and a molecular weight of 499.56 g/mol. Its IUPAC name is (2R)-N-butyl-2-[[2-(3,4-difluoro-N-methylsulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide.
| Compound Name | (2R)-N-butyl-2-[[2-(3,4-difluoro-N-methylsulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 100562420 |
| Molecular Formula | C23H28F3N3O4S |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | (2R)-N-butyl-2-[[2-(3,4-difluoro-N-methylsulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)[C@@H](C)N(Cc1ccccc1F)C(=O)CN(c1ccc(F)c(F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C23H28F3N3O4S/c1-4-5-12-27-23(31)16(2)28(14-17-8-6-7-9-19(17)24)22(30)15-29(34(3,32)33)18-10-11-20(25)21(26)13-18/h6-11,13,16H,4-5,12,14-15H2,1-3H3,(H,27,31)/t16-/m1/s1 |
| InChIKey | NKSPDIISXOHNBX-MRXNPFEDSA-N |
| XLogP | 3.20 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|