C23H28ClF2N3O4S — CID 100555339
(2S)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(3,4-difluoro-N-methylsulfonylanilino)acetyl]amino]propanamide (PubChem CID 100555339) has the molecular formula C23H28ClF2N3O4S and a molecular weight of 516.01 g/mol. Its IUPAC name is (2S)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(3,4-difluoro-N-methylsulfonylanilino)acetyl]amino]propanamide.
| Compound Name | (2S)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(3,4-difluoro-N-methylsulfonylanilino)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 100555339 |
| Molecular Formula | C23H28ClF2N3O4S |
| Molecular Weight | 516.01 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | (2S)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(3,4-difluoro-N-methylsulfonylanilino)acetyl]amino]propanamide |
| SMILES | CCCCNC(=O)[C@H](C)N(Cc1cccc(Cl)c1)C(=O)CN(c1ccc(F)c(F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C23H28ClF2N3O4S/c1-4-5-11-27-23(31)16(2)28(14-17-7-6-8-18(24)12-17)22(30)15-29(34(3,32)33)19-9-10-20(25)21(26)13-19/h6-10,12-13,16H,4-5,11,14-15H2,1-3H3,(H,27,31)/t16-/m0/s1 |
| InChIKey | YCXAUZJETWSFDL-INIZCTEOSA-N |
| XLogP | 3.72 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.01 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|