C24H32ClN3O5S — CID 100553441
(2R)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(3-methoxy-N-methylsulfonylanilino)acetyl]amino]propanamide (PubChem CID 100553441) has the molecular formula C24H32ClN3O5S and a molecular weight of 510.06 g/mol. Its IUPAC name is (2R)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(3-methoxy-N-methylsulfonylanilino)acetyl]amino]propanamide.
| Compound Name | (2R)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(3-methoxy-N-methylsulfonylanilino)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 100553441 |
| Molecular Formula | C24H32ClN3O5S |
| Molecular Weight | 510.06 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | (2R)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(3-methoxy-N-methylsulfonylanilino)acetyl]amino]propanamide |
| SMILES | CCCCNC(=O)[C@@H](C)N(Cc1cccc(Cl)c1)C(=O)CN(c1cccc(OC)c1)S(C)(=O)=O |
| InChI | InChI=1S/C24H32ClN3O5S/c1-5-6-13-26-24(30)18(2)27(16-19-9-7-10-20(25)14-19)23(29)17-28(34(4,31)32)21-11-8-12-22(15-21)33-3/h7-12,14-15,18H,5-6,13,16-17H2,1-4H3,(H,26,30)/t18-/m1/s1 |
| InChIKey | WPVOIEMGDMYTES-GOSISDBHSA-N |
| XLogP | 3.45 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.06 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|