C23H28Cl3N3O4S — CID 133151311
N-butyl-2-[(3-chlorophenyl)methyl-[2-(3,5-dichloro-N-methylsulfonylanilino)acetyl]amino]propanamide (PubChem CID 133151311) has the molecular formula C23H28Cl3N3O4S and a molecular weight of 548.92 g/mol. Its IUPAC name is N-butyl-2-[(3-chlorophenyl)methyl-[2-(3,5-dichloro-N-methylsulfonylanilino)acetyl]amino]propanamide.
| Compound Name | N-butyl-2-[(3-chlorophenyl)methyl-[2-(3,5-dichloro-N-methylsulfonylanilino)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 133151311 |
| Molecular Formula | C23H28Cl3N3O4S |
| Molecular Weight | 548.92 g/mol |
| Exact Mass | 547.09 |
| IUPAC Name | N-butyl-2-[(3-chlorophenyl)methyl-[2-(3,5-dichloro-N-methylsulfonylanilino)acetyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1cccc(Cl)c1)C(=O)CN(c1cc(Cl)cc(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C23H28Cl3N3O4S/c1-4-5-9-27-23(31)16(2)28(14-17-7-6-8-18(24)10-17)22(30)15-29(34(3,32)33)21-12-19(25)11-20(26)13-21/h6-8,10-13,16H,4-5,9,14-15H2,1-3H3,(H,27,31) |
| InChIKey | LZPATXURFLNXQZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.92 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|