C24H31Cl2N3O5S — CID 132737173
N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(3-methoxy-N-methylsulfonylanilino)acetyl]amino]propanamide (PubChem CID 132737173) has the molecular formula C24H31Cl2N3O5S and a molecular weight of 544.50 g/mol. Its IUPAC name is N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(3-methoxy-N-methylsulfonylanilino)acetyl]amino]propanamide.
| Compound Name | N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(3-methoxy-N-methylsulfonylanilino)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 132737173 |
| Molecular Formula | C24H31Cl2N3O5S |
| Molecular Weight | 544.50 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(3-methoxy-N-methylsulfonylanilino)acetyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(Cl)cc1Cl)C(=O)CN(c1cccc(OC)c1)S(C)(=O)=O |
| InChI | InChI=1S/C24H31Cl2N3O5S/c1-5-6-12-27-24(31)17(2)28(15-18-10-11-19(25)13-22(18)26)23(30)16-29(35(4,32)33)20-8-7-9-21(14-20)34-3/h7-11,13-14,17H,5-6,12,15-16H2,1-4H3,(H,27,31) |
| InChIKey | YLLVBPBSVBKUPR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|