C30H36BrN3O6S — CID 133152242
2-[(4-bromophenyl)methyl-[2-(2-methoxy-N-(4-methoxyphenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide (PubChem CID 133152242) has the molecular formula C30H36BrN3O6S and a molecular weight of 646.60 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl-[2-(2-methoxy-N-(4-methoxyphenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide.
| Compound Name | 2-[(4-bromophenyl)methyl-[2-(2-methoxy-N-(4-methoxyphenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 133152242 |
| Molecular Formula | C30H36BrN3O6S |
| Molecular Weight | 646.60 g/mol |
| Exact Mass | 645.15 |
| IUPAC Name | 2-[(4-bromophenyl)methyl-[2-(2-methoxy-N-(4-methoxyphenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(Br)cc1)C(=O)CN(c1ccccc1OC)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C30H36BrN3O6S/c1-5-6-19-32-30(36)22(2)33(20-23-11-13-24(31)14-12-23)29(35)21-34(27-9-7-8-10-28(27)40-4)41(37,38)26-17-15-25(39-3)16-18-26/h7-18,22H,5-6,19-21H2,1-4H3,(H,32,36) |
| InChIKey | ZMSUBXWEWOILND-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|