C32H41N3O6S2 — CID 132755093
N-butyl-2-[[2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide (PubChem CID 132755093) has the molecular formula C32H41N3O6S2 and a molecular weight of 627.83 g/mol. Its IUPAC name is N-butyl-2-[[2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide.
| Compound Name | N-butyl-2-[[2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 132755093 |
| Molecular Formula | C32H41N3O6S2 |
| Molecular Weight | 627.83 g/mol |
| Exact Mass | 627.24 |
| IUPAC Name | N-butyl-2-[[2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(OC)cc1)C(=O)CN(c1ccccc1OCC)S(=O)(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C32H41N3O6S2/c1-6-8-21-33-32(37)24(3)34(22-25-13-15-26(40-4)16-14-25)31(36)23-35(29-11-9-10-12-30(29)41-7-2)43(38,39)28-19-17-27(42-5)18-20-28/h9-20,24H,6-8,21-23H2,1-5H3,(H,33,37) |
| InChIKey | YIZDYGQLMCHXFY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.83 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|