C37H42ClN3O5S2 — CID 100637594
(2S)-N-butyl-2-[(4-chlorophenyl)methyl-[2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 100637594) has the molecular formula C37H42ClN3O5S2 and a molecular weight of 708.35 g/mol. Its IUPAC name is (2S)-N-butyl-2-[(4-chlorophenyl)methyl-[2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[(4-chlorophenyl)methyl-[2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100637594 |
| Molecular Formula | C37H42ClN3O5S2 |
| Molecular Weight | 708.35 g/mol |
| Exact Mass | 707.23 |
| IUPAC Name | (2S)-N-butyl-2-[(4-chlorophenyl)methyl-[2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccc(Cl)cc1)C(=O)CN(c1ccccc1OCC)S(=O)(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C37H42ClN3O5S2/c1-4-6-24-39-37(43)34(25-28-12-8-7-9-13-28)40(26-29-16-18-30(38)19-17-29)36(42)27-41(33-14-10-11-15-35(33)46-5-2)48(44,45)32-22-20-31(47-3)21-23-32/h7-23,34H,4-6,24-27H2,1-3H3,(H,39,43)/t34-/m0/s1 |
| InChIKey | ZKNPIFCDBPWFEJ-UMSFTDKQSA-N |
| XLogP | 7.21 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.35 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|