C36H39ClFN3O5S — CID 100647877
(2S)-N-butyl-2-[[2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)acetyl]-[(2-fluorophenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100647877) has the molecular formula C36H39ClFN3O5S and a molecular weight of 680.24 g/mol. Its IUPAC name is (2S)-N-butyl-2-[[2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)acetyl]-[(2-fluorophenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[[2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)acetyl]-[(2-fluorophenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100647877 |
| Molecular Formula | C36H39ClFN3O5S |
| Molecular Weight | 680.24 g/mol |
| Exact Mass | 679.23 |
| IUPAC Name | (2S)-N-butyl-2-[[2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)acetyl]-[(2-fluorophenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccccc1F)C(=O)CN(c1ccccc1OCC)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C36H39ClFN3O5S/c1-3-5-23-39-36(43)33(24-27-13-7-6-8-14-27)40(25-28-15-9-10-16-31(28)38)35(42)26-41(32-17-11-12-18-34(32)46-4-2)47(44,45)30-21-19-29(37)20-22-30/h6-22,33H,3-5,23-26H2,1-2H3,(H,39,43)/t33-/m0/s1 |
| InChIKey | QDXSDUYDKQIHDQ-XIFFEERXSA-N |
| XLogP | 6.63 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.24 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|