C38H45N3O5S — CID 133258078
N-butyl-2-[[2-(2-ethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 133258078) has the molecular formula C38H45N3O5S and a molecular weight of 655.86 g/mol. Its IUPAC name is N-butyl-2-[[2-(2-ethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[[2-(2-ethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133258078 |
| Molecular Formula | C38H45N3O5S |
| Molecular Weight | 655.86 g/mol |
| Exact Mass | 655.31 |
| IUPAC Name | N-butyl-2-[[2-(2-ethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(C)cc1)C(=O)CN(c1ccccc1OCC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C38H45N3O5S/c1-5-7-25-39-38(43)35(26-31-13-9-8-10-14-31)40(27-32-21-17-29(3)18-22-32)37(42)28-41(34-15-11-12-16-36(34)46-6-2)47(44,45)33-23-19-30(4)20-24-33/h8-24,35H,5-7,25-28H2,1-4H3,(H,39,43) |
| InChIKey | USOBUUGPQWZTLV-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.86 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|