C38H45N3O4S — CID 100600328
(2S)-N-butyl-2-[[2-(2-ethyl-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100600328) has the molecular formula C38H45N3O4S and a molecular weight of 639.86 g/mol. Its IUPAC name is (2S)-N-butyl-2-[[2-(2-ethyl-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[[2-(2-ethyl-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100600328 |
| Molecular Formula | C38H45N3O4S |
| Molecular Weight | 639.86 g/mol |
| Exact Mass | 639.31 |
| IUPAC Name | (2S)-N-butyl-2-[[2-(2-ethyl-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccc(C)cc1)C(=O)CN(c1ccccc1CC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C38H45N3O4S/c1-5-7-25-39-38(43)36(26-31-13-9-8-10-14-31)40(27-32-21-17-29(3)18-22-32)37(42)28-41(35-16-12-11-15-33(35)6-2)46(44,45)34-23-19-30(4)20-24-34/h8-24,36H,5-7,25-28H2,1-4H3,(H,39,43)/t36-/m0/s1 |
| InChIKey | NGXHVHMIQCZOKR-BHVANESWSA-N |
| XLogP | 6.62 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.86 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|