C37H41Cl2N3O5S — CID 133207079
N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(2-ethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 133207079) has the molecular formula C37H41Cl2N3O5S and a molecular weight of 710.72 g/mol. Its IUPAC name is N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(2-ethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(2-ethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133207079 |
| Molecular Formula | C37H41Cl2N3O5S |
| Molecular Weight | 710.72 g/mol |
| Exact Mass | 709.21 |
| IUPAC Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(2-ethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN(c1ccccc1OCC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C37H41Cl2N3O5S/c1-4-6-22-40-37(44)34(24-28-12-8-7-9-13-28)41(25-29-18-21-31(38)32(39)23-29)36(43)26-42(33-14-10-11-15-35(33)47-5-2)48(45,46)30-19-16-27(3)17-20-30/h7-21,23,34H,4-6,22,24-26H2,1-3H3,(H,40,44) |
| InChIKey | UDQVEZRHWYWELI-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.72 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|