C37H41Cl2N3O4S — CID 100690723
(2R)-N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(2,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 100690723) has the molecular formula C37H41Cl2N3O4S and a molecular weight of 694.73 g/mol. Its IUPAC name is (2R)-N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(2,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(2,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100690723 |
| Molecular Formula | C37H41Cl2N3O4S |
| Molecular Weight | 694.73 g/mol |
| Exact Mass | 693.22 |
| IUPAC Name | (2R)-N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(2,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN(c1ccc(C)cc1C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C37H41Cl2N3O4S/c1-5-6-20-40-37(44)35(23-29-10-8-7-9-11-29)41(24-30-15-18-32(38)33(39)22-30)36(43)25-42(34-19-14-27(3)21-28(34)4)47(45,46)31-16-12-26(2)13-17-31/h7-19,21-22,35H,5-6,20,23-25H2,1-4H3,(H,40,44)/t35-/m1/s1 |
| InChIKey | OLZPMHLVZNKIDI-PGUFJCEWSA-N |
| XLogP | 7.67 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.73 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|