C35H35Cl4N3O4S — CID 133207263
N-butyl-2-[[2-(2,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(3,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 133207263) has the molecular formula C35H35Cl4N3O4S and a molecular weight of 735.56 g/mol. Its IUPAC name is N-butyl-2-[[2-(2,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(3,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[[2-(2,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(3,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133207263 |
| Molecular Formula | C35H35Cl4N3O4S |
| Molecular Weight | 735.56 g/mol |
| Exact Mass | 733.11 |
| IUPAC Name | N-butyl-2-[[2-(2,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(3,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN(c1cc(Cl)ccc1Cl)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C35H35Cl4N3O4S/c1-3-4-18-40-35(44)33(20-25-8-6-5-7-9-25)41(22-26-12-16-29(37)31(39)19-26)34(43)23-42(32-21-27(36)13-17-30(32)38)47(45,46)28-14-10-24(2)11-15-28/h5-17,19,21,33H,3-4,18,20,22-23H2,1-2H3,(H,40,44) |
| InChIKey | SCGBDKJFDXVYBV-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.56 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|