C41H41Cl2N3O5S — CID 100695755
(2S)-N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(N-(4-methylphenyl)sulfonyl-4-phenoxyanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 100695755) has the molecular formula C41H41Cl2N3O5S and a molecular weight of 758.77 g/mol. Its IUPAC name is (2S)-N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(N-(4-methylphenyl)sulfonyl-4-phenoxyanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(N-(4-methylphenyl)sulfonyl-4-phenoxyanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100695755 |
| Molecular Formula | C41H41Cl2N3O5S |
| Molecular Weight | 758.77 g/mol |
| Exact Mass | 757.21 |
| IUPAC Name | (2S)-N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(N-(4-methylphenyl)sulfonyl-4-phenoxyanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN(c1ccc(Oc2ccccc2)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C41H41Cl2N3O5S/c1-3-4-25-44-41(48)39(27-31-11-7-5-8-12-31)45(28-32-17-24-37(42)38(43)26-32)40(47)29-46(52(49,50)36-22-15-30(2)16-23-36)33-18-20-35(21-19-33)51-34-13-9-6-10-14-34/h5-24,26,39H,3-4,25,27-29H2,1-2H3,(H,44,48)/t39-/m0/s1 |
| InChIKey | LSHVMIBTPZCKCX-KDXMTYKHSA-N |
| XLogP | 8.85 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.77 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|