C41H42ClN3O5S — CID 100639860
(2S)-N-butyl-2-[(4-chlorophenyl)methyl-[2-(N-(4-methylphenyl)sulfonyl-4-phenoxyanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 100639860) has the molecular formula C41H42ClN3O5S and a molecular weight of 724.32 g/mol. Its IUPAC name is (2S)-N-butyl-2-[(4-chlorophenyl)methyl-[2-(N-(4-methylphenyl)sulfonyl-4-phenoxyanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[(4-chlorophenyl)methyl-[2-(N-(4-methylphenyl)sulfonyl-4-phenoxyanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100639860 |
| Molecular Formula | C41H42ClN3O5S |
| Molecular Weight | 724.32 g/mol |
| Exact Mass | 723.25 |
| IUPAC Name | (2S)-N-butyl-2-[(4-chlorophenyl)methyl-[2-(N-(4-methylphenyl)sulfonyl-4-phenoxyanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccc(Cl)cc1)C(=O)CN(c1ccc(Oc2ccccc2)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C41H42ClN3O5S/c1-3-4-27-43-41(47)39(28-32-11-7-5-8-12-32)44(29-33-17-19-34(42)20-18-33)40(46)30-45(51(48,49)38-25-15-31(2)16-26-38)35-21-23-37(24-22-35)50-36-13-9-6-10-14-36/h5-26,39H,3-4,27-30H2,1-2H3,(H,43,47)/t39-/m0/s1 |
| InChIKey | MWYMDHIWAQRVIC-KDXMTYKHSA-N |
| XLogP | 8.19 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.32 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|