C25H35N3O5S — CID 132986761
2-[benzyl-[2-(2-ethoxy-N-methylsulfonylanilino)acetyl]amino]-N-butylpropanamide (PubChem CID 132986761) has the molecular formula C25H35N3O5S and a molecular weight of 489.64 g/mol. Its IUPAC name is 2-[benzyl-[2-(2-ethoxy-N-methylsulfonylanilino)acetyl]amino]-N-butylpropanamide.
| Compound Name | 2-[benzyl-[2-(2-ethoxy-N-methylsulfonylanilino)acetyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 132986761 |
| Molecular Formula | C25H35N3O5S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 2-[benzyl-[2-(2-ethoxy-N-methylsulfonylanilino)acetyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccccc1)C(=O)CN(c1ccccc1OCC)S(C)(=O)=O |
| InChI | InChI=1S/C25H35N3O5S/c1-5-7-17-26-25(30)20(3)27(18-21-13-9-8-10-14-21)24(29)19-28(34(4,31)32)22-15-11-12-16-23(22)33-6-2/h8-16,20H,5-7,17-19H2,1-4H3,(H,26,30) |
| InChIKey | RRMWNAXIAJSMIU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|