C25H34BrN3O6S — CID 100567830
(2S)-2-[(3-bromophenyl)methyl-[2-(2,5-dimethoxy-N-methylsulfonylanilino)acetyl]amino]-N-butylpropanamide (PubChem CID 100567830) has the molecular formula C25H34BrN3O6S and a molecular weight of 584.53 g/mol. Its IUPAC name is (2S)-2-[(3-bromophenyl)methyl-[2-(2,5-dimethoxy-N-methylsulfonylanilino)acetyl]amino]-N-butylpropanamide.
| Compound Name | (2S)-2-[(3-bromophenyl)methyl-[2-(2,5-dimethoxy-N-methylsulfonylanilino)acetyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 100567830 |
| Molecular Formula | C25H34BrN3O6S |
| Molecular Weight | 584.53 g/mol |
| Exact Mass | 583.14 |
| IUPAC Name | (2S)-2-[(3-bromophenyl)methyl-[2-(2,5-dimethoxy-N-methylsulfonylanilino)acetyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)[C@H](C)N(Cc1cccc(Br)c1)C(=O)CN(c1cc(OC)ccc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C25H34BrN3O6S/c1-6-7-13-27-25(31)18(2)28(16-19-9-8-10-20(26)14-19)24(30)17-29(36(5,32)33)22-15-21(34-3)11-12-23(22)35-4/h8-12,14-15,18H,6-7,13,16-17H2,1-5H3,(H,27,31)/t18-/m0/s1 |
| InChIKey | HJBSSEKEUSSARM-SFHVURJKSA-N |
| XLogP | 3.57 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|