C33H43N3O6S — CID 132752192
N-butyl-2-[[2-(2-methoxy-5-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]butanamide (PubChem CID 132752192) has the molecular formula C33H43N3O6S and a molecular weight of 609.79 g/mol. Its IUPAC name is N-butyl-2-[[2-(2-methoxy-5-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]butanamide.
| Compound Name | N-butyl-2-[[2-(2-methoxy-5-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132752192 |
| Molecular Formula | C33H43N3O6S |
| Molecular Weight | 609.79 g/mol |
| Exact Mass | 609.29 |
| IUPAC Name | N-butyl-2-[[2-(2-methoxy-5-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1cccc(OC)c1)C(=O)CN(c1cc(C)ccc1OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C33H43N3O6S/c1-7-9-19-34-33(38)29(8-2)35(22-26-11-10-12-27(21-26)41-5)32(37)23-36(30-20-25(4)15-18-31(30)42-6)43(39,40)28-16-13-24(3)14-17-28/h10-18,20-21,29H,7-9,19,22-23H2,1-6H3,(H,34,38) |
| InChIKey | DGHCKWFXLRGPFJ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.79 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|