C32H41N3O5S — CID 132745567
2-[[2-[N-(benzenesulfonyl)-2,5-dimethylanilino]acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butylbutanamide (PubChem CID 132745567) has the molecular formula C32H41N3O5S and a molecular weight of 579.76 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-2,5-dimethylanilino]acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butylbutanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-2,5-dimethylanilino]acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butylbutanamide |
|---|---|
| PubChem CID | 132745567 |
| Molecular Formula | C32H41N3O5S |
| Molecular Weight | 579.76 g/mol |
| Exact Mass | 579.28 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-2,5-dimethylanilino]acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butylbutanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1cccc(OC)c1)C(=O)CN(c1cc(C)ccc1C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H41N3O5S/c1-6-8-19-33-32(37)29(7-2)34(22-26-13-12-14-27(21-26)40-5)31(36)23-35(30-20-24(3)17-18-25(30)4)41(38,39)28-15-10-9-11-16-28/h9-18,20-21,29H,6-8,19,22-23H2,1-5H3,(H,33,37) |
| InChIKey | XPZQRPWFPLYQBY-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.76 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|