C32H40ClN3O5S — CID 132752876
N-butyl-2-[(2-chlorophenyl)methyl-[2-(2-methoxy-5-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]butanamide (PubChem CID 132752876) has the molecular formula C32H40ClN3O5S and a molecular weight of 614.21 g/mol. Its IUPAC name is N-butyl-2-[(2-chlorophenyl)methyl-[2-(2-methoxy-5-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]butanamide.
| Compound Name | N-butyl-2-[(2-chlorophenyl)methyl-[2-(2-methoxy-5-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 132752876 |
| Molecular Formula | C32H40ClN3O5S |
| Molecular Weight | 614.21 g/mol |
| Exact Mass | 613.24 |
| IUPAC Name | N-butyl-2-[(2-chlorophenyl)methyl-[2-(2-methoxy-5-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccccc1Cl)C(=O)CN(c1cc(C)ccc1OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C32H40ClN3O5S/c1-6-8-19-34-32(38)28(7-2)35(21-25-11-9-10-12-27(25)33)31(37)22-36(29-20-24(4)15-18-30(29)41-5)42(39,40)26-16-13-23(3)14-17-26/h9-18,20,28H,6-8,19,21-22H2,1-5H3,(H,34,38) |
| InChIKey | XHQDLAGJUFCZHZ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.21 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|