C31H37Cl2N3O5S — CID 132755885
N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(2-methoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]butanamide (PubChem CID 132755885) has the molecular formula C31H37Cl2N3O5S and a molecular weight of 634.63 g/mol. Its IUPAC name is N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(2-methoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]butanamide.
| Compound Name | N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(2-methoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 132755885 |
| Molecular Formula | C31H37Cl2N3O5S |
| Molecular Weight | 634.63 g/mol |
| Exact Mass | 633.18 |
| IUPAC Name | N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(2-methoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccc(Cl)cc1Cl)C(=O)CN(c1ccccc1OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C31H37Cl2N3O5S/c1-5-7-18-34-31(38)27(6-2)35(20-23-14-15-24(32)19-26(23)33)30(37)21-36(28-10-8-9-11-29(28)41-4)42(39,40)25-16-12-22(3)13-17-25/h8-17,19,27H,5-7,18,20-21H2,1-4H3,(H,34,38) |
| InChIKey | UYRXDQWZTDFJLK-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.63 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|