C33H43N3O5S — CID 132748918
N-butyl-2-[[2-(2-methoxy-5-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]butanamide (PubChem CID 132748918) has the molecular formula C33H43N3O5S and a molecular weight of 593.79 g/mol. Its IUPAC name is N-butyl-2-[[2-(2-methoxy-5-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]butanamide.
| Compound Name | N-butyl-2-[[2-(2-methoxy-5-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132748918 |
| Molecular Formula | C33H43N3O5S |
| Molecular Weight | 593.79 g/mol |
| Exact Mass | 593.29 |
| IUPAC Name | N-butyl-2-[[2-(2-methoxy-5-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1cccc(C)c1)C(=O)CN(c1cc(C)ccc1OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C33H43N3O5S/c1-7-9-19-34-33(38)29(8-2)35(22-27-12-10-11-25(4)20-27)32(37)23-36(30-21-26(5)15-18-31(30)41-6)42(39,40)28-16-13-24(3)14-17-28/h10-18,20-21,29H,7-9,19,22-23H2,1-6H3,(H,34,38) |
| InChIKey | GETIQYSFXVUSTP-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.79 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|