C38H44ClN3O7S — CID 100623598
(2R)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 100623598) has the molecular formula C38H44ClN3O7S and a molecular weight of 722.30 g/mol. Its IUPAC name is (2R)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100623598 |
| Molecular Formula | C38H44ClN3O7S |
| Molecular Weight | 722.30 g/mol |
| Exact Mass | 721.26 |
| IUPAC Name | (2R)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1cccc(Cl)c1)C(=O)CN(c1ccc(OCC)cc1)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C38H44ClN3O7S/c1-5-7-22-40-38(44)34(24-28-12-9-8-10-13-28)41(26-29-14-11-15-30(39)23-29)37(43)27-42(31-16-18-32(19-17-31)49-6-2)50(45,46)33-20-21-35(47-3)36(25-33)48-4/h8-21,23,25,34H,5-7,22,24,26-27H2,1-4H3,(H,40,44)/t34-/m1/s1 |
| InChIKey | CTOJQAXZIOADTE-UUWRZZSWSA-N |
| XLogP | 6.51 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.30 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|