C37H42ClN3O6S — CID 100709778
(2R)-N-butyl-2-[[2-(N-(4-chlorophenyl)sulfonyl-4-ethoxyanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100709778) has the molecular formula C37H42ClN3O6S and a molecular weight of 692.28 g/mol. Its IUPAC name is (2R)-N-butyl-2-[[2-(N-(4-chlorophenyl)sulfonyl-4-ethoxyanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[[2-(N-(4-chlorophenyl)sulfonyl-4-ethoxyanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100709778 |
| Molecular Formula | C37H42ClN3O6S |
| Molecular Weight | 692.28 g/mol |
| Exact Mass | 691.25 |
| IUPAC Name | (2R)-N-butyl-2-[[2-(N-(4-chlorophenyl)sulfonyl-4-ethoxyanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1cccc(OC)c1)C(=O)CN(c1ccc(OCC)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C37H42ClN3O6S/c1-4-6-23-39-37(43)35(25-28-11-8-7-9-12-28)40(26-29-13-10-14-33(24-29)46-3)36(42)27-41(31-17-19-32(20-18-31)47-5-2)48(44,45)34-21-15-30(38)16-22-34/h7-22,24,35H,4-6,23,25-27H2,1-3H3,(H,39,43)/t35-/m1/s1 |
| InChIKey | SFJZHFZOFVCQPF-PGUFJCEWSA-N |
| XLogP | 6.50 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.28 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|