C38H45N3O6S2 — CID 100709720
(2R)-N-butyl-2-[[2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100709720) has the molecular formula C38H45N3O6S2 and a molecular weight of 703.93 g/mol. Its IUPAC name is (2R)-N-butyl-2-[[2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[[2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100709720 |
| Molecular Formula | C38H45N3O6S2 |
| Molecular Weight | 703.93 g/mol |
| Exact Mass | 703.27 |
| IUPAC Name | (2R)-N-butyl-2-[[2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1cccc(OC)c1)C(=O)CN(c1ccc(OCC)cc1)S(=O)(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C38H45N3O6S2/c1-5-7-24-39-38(43)36(26-29-12-9-8-10-13-29)40(27-30-14-11-15-33(25-30)46-3)37(42)28-41(31-16-18-32(19-17-31)47-6-2)49(44,45)35-22-20-34(48-4)21-23-35/h8-23,25,36H,5-7,24,26-28H2,1-4H3,(H,39,43)/t36-/m1/s1 |
| InChIKey | NTVBVBXJVPCFQT-PSXMRANNSA-N |
| XLogP | 6.57 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.93 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|