C37H41BrClN3O7S — CID 100675455
(2R)-2-[(4-bromophenyl)methyl-[2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)acetyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100675455) has the molecular formula C37H41BrClN3O7S and a molecular weight of 787.17 g/mol. Its IUPAC name is (2R)-2-[(4-bromophenyl)methyl-[2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)acetyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[(4-bromophenyl)methyl-[2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)acetyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100675455 |
| Molecular Formula | C37H41BrClN3O7S |
| Molecular Weight | 787.17 g/mol |
| Exact Mass | 785.15 |
| IUPAC Name | (2R)-2-[(4-bromophenyl)methyl-[2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)acetyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccc(Br)cc1)C(=O)CN(c1cc(Cl)ccc1OC)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C37H41BrClN3O7S/c1-5-6-20-40-37(44)32(21-26-10-8-7-9-11-26)41(24-27-12-14-28(38)15-13-27)36(43)25-42(31-22-29(39)16-18-33(31)47-2)50(45,46)30-17-19-34(48-3)35(23-30)49-4/h7-19,22-23,32H,5-6,20-21,24-25H2,1-4H3,(H,40,44)/t32-/m1/s1 |
| InChIKey | UEZAYRQOKPHMBF-JGCGQSQUSA-N |
| XLogP | 6.88 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.17 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|