C36H40FN3O6S — CID 100647982
(2S)-N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100647982) has the molecular formula C36H40FN3O6S and a molecular weight of 661.80 g/mol. Its IUPAC name is (2S)-N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100647982 |
| Molecular Formula | C36H40FN3O6S |
| Molecular Weight | 661.80 g/mol |
| Exact Mass | 661.26 |
| IUPAC Name | (2S)-N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccccc1F)C(=O)CN(c1ccccc1)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C36H40FN3O6S/c1-4-5-22-38-36(42)32(23-27-14-8-6-9-15-27)39(25-28-16-12-13-19-31(28)37)35(41)26-40(29-17-10-7-11-18-29)47(43,44)30-20-21-33(45-2)34(24-30)46-3/h6-21,24,32H,4-5,22-23,25-26H2,1-3H3,(H,38,42)/t32-/m0/s1 |
| InChIKey | WNVLMGMSYJECDB-YTTGMZPUSA-N |
| XLogP | 5.59 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.80 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|