C33H42FN3O6S — CID 132755041
N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]-[(4-fluorophenyl)methyl]amino]butanamide (PubChem CID 132755041) has the molecular formula C33H42FN3O6S and a molecular weight of 627.78 g/mol. Its IUPAC name is N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]-[(4-fluorophenyl)methyl]amino]butanamide.
| Compound Name | N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]-[(4-fluorophenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132755041 |
| Molecular Formula | C33H42FN3O6S |
| Molecular Weight | 627.78 g/mol |
| Exact Mass | 627.28 |
| IUPAC Name | N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]-[(4-fluorophenyl)methyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccc(F)cc1)C(=O)CN(c1cc(C)cc(C)c1)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C33H42FN3O6S/c1-7-9-16-35-33(39)29(8-2)36(21-25-10-12-26(34)13-11-25)32(38)22-37(27-18-23(3)17-24(4)19-27)44(40,41)28-14-15-30(42-5)31(20-28)43-6/h10-15,17-20,29H,7-9,16,21-22H2,1-6H3,(H,35,39) |
| InChIKey | OSUYNCCIZAPZIG-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.78 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|