C32H40BrN3O6S — CID 133152219
2-[(4-bromophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]amino]-N-butylpropanamide (PubChem CID 133152219) has the molecular formula C32H40BrN3O6S and a molecular weight of 674.66 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]amino]-N-butylpropanamide.
| Compound Name | 2-[(4-bromophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 133152219 |
| Molecular Formula | C32H40BrN3O6S |
| Molecular Weight | 674.66 g/mol |
| Exact Mass | 673.18 |
| IUPAC Name | 2-[(4-bromophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(Br)cc1)C(=O)CN(c1cc(C)cc(C)c1)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C32H40BrN3O6S/c1-7-8-15-34-32(38)24(4)35(20-25-9-11-26(33)12-10-25)31(37)21-36(27-17-22(2)16-23(3)18-27)43(39,40)28-13-14-29(41-5)30(19-28)42-6/h9-14,16-19,24H,7-8,15,20-21H2,1-6H3,(H,34,38) |
| InChIKey | IRTOMBRMHQJPGX-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.66 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|