C32H40BrN3O7S — CID 133152234
2-[(4-bromophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetyl]amino]-N-butylpropanamide (PubChem CID 133152234) has the molecular formula C32H40BrN3O7S and a molecular weight of 690.66 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetyl]amino]-N-butylpropanamide.
| Compound Name | 2-[(4-bromophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 133152234 |
| Molecular Formula | C32H40BrN3O7S |
| Molecular Weight | 690.66 g/mol |
| Exact Mass | 689.18 |
| IUPAC Name | 2-[(4-bromophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(Br)cc1)C(=O)CN(c1ccc(OCC)cc1)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C32H40BrN3O7S/c1-6-8-19-34-32(38)23(3)35(21-24-9-11-25(33)12-10-24)31(37)22-36(26-13-15-27(16-14-26)43-7-2)44(39,40)28-17-18-29(41-4)30(20-28)42-5/h9-18,20,23H,6-8,19,21-22H2,1-5H3,(H,34,38) |
| InChIKey | HYXYXDBETHFJCH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.66 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|