C31H38BrN3O6S — CID 132758279
2-[[2-(N-(4-bromophenyl)sulfonyl-4-ethoxyanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butylpropanamide (PubChem CID 132758279) has the molecular formula C31H38BrN3O6S and a molecular weight of 660.63 g/mol. Its IUPAC name is 2-[[2-(N-(4-bromophenyl)sulfonyl-4-ethoxyanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butylpropanamide.
| Compound Name | 2-[[2-(N-(4-bromophenyl)sulfonyl-4-ethoxyanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 132758279 |
| Molecular Formula | C31H38BrN3O6S |
| Molecular Weight | 660.63 g/mol |
| Exact Mass | 659.17 |
| IUPAC Name | 2-[[2-(N-(4-bromophenyl)sulfonyl-4-ethoxyanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1cccc(OC)c1)C(=O)CN(c1ccc(OCC)cc1)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C31H38BrN3O6S/c1-5-7-19-33-31(37)23(3)34(21-24-9-8-10-28(20-24)40-4)30(36)22-35(26-13-15-27(16-14-26)41-6-2)42(38,39)29-17-11-25(32)12-18-29/h8-18,20,23H,5-7,19,21-22H2,1-4H3,(H,33,37) |
| InChIKey | QPOVDZWCFALPDP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.63 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|