C31H38BrN3O4S — CID 133151823
2-[(3-bromophenyl)methyl-[2-(3,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide (PubChem CID 133151823) has the molecular formula C31H38BrN3O4S and a molecular weight of 628.63 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl-[2-(3,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide.
| Compound Name | 2-[(3-bromophenyl)methyl-[2-(3,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 133151823 |
| Molecular Formula | C31H38BrN3O4S |
| Molecular Weight | 628.63 g/mol |
| Exact Mass | 627.18 |
| IUPAC Name | 2-[(3-bromophenyl)methyl-[2-(3,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1cccc(Br)c1)C(=O)CN(c1ccc(C)c(C)c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C31H38BrN3O4S/c1-6-7-17-33-31(37)25(5)34(20-26-9-8-10-27(32)19-26)30(36)21-35(28-14-13-23(3)24(4)18-28)40(38,39)29-15-11-22(2)12-16-29/h8-16,18-19,25H,6-7,17,20-21H2,1-5H3,(H,33,37) |
| InChIKey | RYVIFROGTJTTGL-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.63 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|