C22H27F3N2O3S — CID 127046267
N-hexyl-2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetamide (PubChem CID 127046267) has the molecular formula C22H27F3N2O3S and a molecular weight of 456.53 g/mol. Its IUPAC name is N-hexyl-2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-hexyl-2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 127046267 |
| Molecular Formula | C22H27F3N2O3S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | N-hexyl-2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetamide |
| SMILES | CCCCCCNC(=O)CN(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H27F3N2O3S/c1-3-4-5-6-14-26-21(28)16-27(19-9-7-8-18(15-19)22(23,24)25)31(29,30)20-12-10-17(2)11-13-20/h7-13,15H,3-6,14,16H2,1-2H3,(H,26,28) |
| InChIKey | BJXGBUQBEFYRMG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|