C25H23Cl2F3N2O3S2 — CID 126031786
N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetamide (PubChem CID 126031786) has the molecular formula C25H23Cl2F3N2O3S2 and a molecular weight of 591.50 g/mol. Its IUPAC name is N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 126031786 |
| Molecular Formula | C25H23Cl2F3N2O3S2 |
| Molecular Weight | 591.50 g/mol |
| Exact Mass | 590.05 |
| IUPAC Name | N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCCSCc2c(Cl)cccc2Cl)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C25H23Cl2F3N2O3S2/c1-17-8-10-20(11-9-17)37(34,35)32(19-5-2-4-18(14-19)25(28,29)30)15-24(33)31-12-13-36-16-21-22(26)6-3-7-23(21)27/h2-11,14H,12-13,15-16H2,1H3,(H,31,33) |
| InChIKey | RSRNPDDXBIAJRP-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.50 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|