C26H28Cl2N2O3S2 — CID 126031772
N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-(3,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 126031772) has the molecular formula C26H28Cl2N2O3S2 and a molecular weight of 551.56 g/mol. Its IUPAC name is N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-(3,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-(3,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126031772 |
| Molecular Formula | C26H28Cl2N2O3S2 |
| Molecular Weight | 551.56 g/mol |
| Exact Mass | 550.09 |
| IUPAC Name | N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-(3,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCCSCc2c(Cl)cccc2Cl)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C26H28Cl2N2O3S2/c1-18-7-11-22(12-8-18)35(32,33)30(21-10-9-19(2)20(3)15-21)16-26(31)29-13-14-34-17-23-24(27)5-4-6-25(23)28/h4-12,15H,13-14,16-17H2,1-3H3,(H,29,31) |
| InChIKey | RLZNDNNINKLBEL-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.56 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|