C25H25Cl3N2O3S2 — CID 126034452
2-(5-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 126034452) has the molecular formula C25H25Cl3N2O3S2 and a molecular weight of 571.98 g/mol. Its IUPAC name is 2-(5-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-(5-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 126034452 |
| Molecular Formula | C25H25Cl3N2O3S2 |
| Molecular Weight | 571.98 g/mol |
| Exact Mass | 570.04 |
| IUPAC Name | 2-(5-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCCSCc2c(Cl)cccc2Cl)c2cc(Cl)ccc2C)cc1 |
| InChI | InChI=1S/C25H25Cl3N2O3S2/c1-17-6-10-20(11-7-17)35(32,33)30(24-14-19(26)9-8-18(24)2)15-25(31)29-12-13-34-16-21-22(27)4-3-5-23(21)28/h3-11,14H,12-13,15-16H2,1-2H3,(H,29,31) |
| InChIKey | YTGGDXVMURQVLH-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.98 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|