C25H26Cl2N2O3S2 — CID 51344534
2-(4-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 51344534) has the molecular formula C25H26Cl2N2O3S2 and a molecular weight of 537.53 g/mol. Its IUPAC name is 2-(4-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-(4-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 51344534 |
| Molecular Formula | C25H26Cl2N2O3S2 |
| Molecular Weight | 537.53 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | 2-(4-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCCSCc2ccccc2Cl)c2ccc(Cl)cc2C)cc1 |
| InChI | InChI=1S/C25H26Cl2N2O3S2/c1-18-7-10-22(11-8-18)34(31,32)29(24-12-9-21(26)15-19(24)2)16-25(30)28-13-14-33-17-20-5-3-4-6-23(20)27/h3-12,15H,13-14,16-17H2,1-2H3,(H,28,30) |
| InChIKey | GJYJLHMNYDGMBB-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.53 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|