C25H27ClN2O3S3 — CID 51344983
N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide (PubChem CID 51344983) has the molecular formula C25H27ClN2O3S3 and a molecular weight of 535.16 g/mol. Its IUPAC name is N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 51344983 |
| Molecular Formula | C25H27ClN2O3S3 |
| Molecular Weight | 535.16 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide |
| SMILES | CSc1ccc(S(=O)(=O)N(CC(=O)NCCSCc2ccccc2Cl)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H27ClN2O3S3/c1-19-7-9-21(10-8-19)28(34(30,31)23-13-11-22(32-2)12-14-23)17-25(29)27-15-16-33-18-20-5-3-4-6-24(20)26/h3-14H,15-18H2,1-2H3,(H,27,29) |
| InChIKey | WPRYBAOCXAYPLZ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.16 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|