C24H23Cl2FN2O3S2 — CID 43880909
N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(4-fluoro-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 43880909) has the molecular formula C24H23Cl2FN2O3S2 and a molecular weight of 541.50 g/mol. Its IUPAC name is N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(4-fluoro-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(4-fluoro-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 43880909 |
| Molecular Formula | C24H23Cl2FN2O3S2 |
| Molecular Weight | 541.50 g/mol |
| Exact Mass | 540.05 |
| IUPAC Name | N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(4-fluoro-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCCSCc2ccc(Cl)cc2Cl)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H23Cl2FN2O3S2/c1-17-2-10-22(11-3-17)34(31,32)29(21-8-6-20(27)7-9-21)15-24(30)28-12-13-33-16-18-4-5-19(25)14-23(18)26/h2-11,14H,12-13,15-16H2,1H3,(H,28,30) |
| InChIKey | KMSKREWEWJCNPO-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.50 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|