C25H28N2O3S2 — CID 126033059
N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]-2-(N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 126033059) has the molecular formula C25H28N2O3S2 and a molecular weight of 468.64 g/mol. Its IUPAC name is N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]-2-(N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]-2-(N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126033059 |
| Molecular Formula | C25H28N2O3S2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]-2-(N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCCSCc2ccccc2C)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H28N2O3S2/c1-20-12-14-24(15-13-20)32(29,30)27(23-10-4-3-5-11-23)18-25(28)26-16-17-31-19-22-9-7-6-8-21(22)2/h3-15H,16-19H2,1-2H3,(H,26,28) |
| InChIKey | RPKATUPOKMIQME-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|