C26H29N3O6S2 — CID 126035393
2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 126035393) has the molecular formula C26H29N3O6S2 and a molecular weight of 543.67 g/mol. Its IUPAC name is 2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 126035393 |
| Molecular Formula | C26H29N3O6S2 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | 2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | COc1ccc(N(CC(=O)NCCSCc2ccccc2C)S(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C26H29N3O6S2/c1-19-6-4-5-7-21(19)18-36-15-14-27-26(30)17-28(22-9-11-23(35-3)12-10-22)37(33,34)24-13-8-20(2)25(16-24)29(31)32/h4-13,16H,14-15,17-18H2,1-3H3,(H,27,30) |
| InChIKey | VQGIBJMPFXGKIS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|