C27H31ClN2O3S2 — CID 30216468
2-(4-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[3-[(2-methylphenyl)methylsulfanyl]propyl]acetamide (PubChem CID 30216468) has the molecular formula C27H31ClN2O3S2 and a molecular weight of 531.14 g/mol. Its IUPAC name is 2-(4-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[3-[(2-methylphenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-(4-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[3-[(2-methylphenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 30216468 |
| Molecular Formula | C27H31ClN2O3S2 |
| Molecular Weight | 531.14 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | 2-(4-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[3-[(2-methylphenyl)methylsulfanyl]propyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCCCSCc2ccccc2C)c2ccc(Cl)cc2C)cc1 |
| InChI | InChI=1S/C27H31ClN2O3S2/c1-20-9-12-25(13-10-20)35(32,33)30(26-14-11-24(28)17-22(26)3)18-27(31)29-15-6-16-34-19-23-8-5-4-7-21(23)2/h4-5,7-14,17H,6,15-16,18-19H2,1-3H3,(H,29,31) |
| InChIKey | QMTITACJZWFSOB-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.14 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|