C26H29ClN2O3S2 — CID 30250778
2-(N-(4-chlorophenyl)sulfonyl-2-methylanilino)-N-[3-[(2-methylphenyl)methylsulfanyl]propyl]acetamide (PubChem CID 30250778) has the molecular formula C26H29ClN2O3S2 and a molecular weight of 517.12 g/mol. Its IUPAC name is 2-(N-(4-chlorophenyl)sulfonyl-2-methylanilino)-N-[3-[(2-methylphenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-(N-(4-chlorophenyl)sulfonyl-2-methylanilino)-N-[3-[(2-methylphenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 30250778 |
| Molecular Formula | C26H29ClN2O3S2 |
| Molecular Weight | 517.12 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | 2-(N-(4-chlorophenyl)sulfonyl-2-methylanilino)-N-[3-[(2-methylphenyl)methylsulfanyl]propyl]acetamide |
| SMILES | Cc1ccccc1CSCCCNC(=O)CN(c1ccccc1C)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H29ClN2O3S2/c1-20-8-3-5-10-22(20)19-33-17-7-16-28-26(30)18-29(25-11-6-4-9-21(25)2)34(31,32)24-14-12-23(27)13-15-24/h3-6,8-15H,7,16-19H2,1-2H3,(H,28,30) |
| InChIKey | MECWABRQGMSKBL-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.12 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|