C26H29FN2O3S2 — CID 30242959
2-[N-(benzenesulfonyl)-2,3-dimethylanilino]-N-[3-[(2-fluorophenyl)methylsulfanyl]propyl]acetamide (PubChem CID 30242959) has the molecular formula C26H29FN2O3S2 and a molecular weight of 500.66 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,3-dimethylanilino]-N-[3-[(2-fluorophenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2,3-dimethylanilino]-N-[3-[(2-fluorophenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 30242959 |
| Molecular Formula | C26H29FN2O3S2 |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,3-dimethylanilino]-N-[3-[(2-fluorophenyl)methylsulfanyl]propyl]acetamide |
| SMILES | Cc1cccc(N(CC(=O)NCCCSCc2ccccc2F)S(=O)(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C26H29FN2O3S2/c1-20-10-8-15-25(21(20)2)29(34(31,32)23-12-4-3-5-13-23)18-26(30)28-16-9-17-33-19-22-11-6-7-14-24(22)27/h3-8,10-15H,9,16-19H2,1-2H3,(H,28,30) |
| InChIKey | DCQAXCMEBYOCER-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|