C26H27F3N2O3S2 — CID 43892636
2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]-N-[3-[(2-methylphenyl)methylsulfanyl]propyl]acetamide (PubChem CID 43892636) has the molecular formula C26H27F3N2O3S2 and a molecular weight of 536.64 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]-N-[3-[(2-methylphenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]-N-[3-[(2-methylphenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 43892636 |
| Molecular Formula | C26H27F3N2O3S2 |
| Molecular Weight | 536.64 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]-N-[3-[(2-methylphenyl)methylsulfanyl]propyl]acetamide |
| SMILES | Cc1ccccc1CSCCCNC(=O)CN(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H27F3N2O3S2/c1-20-9-5-6-10-21(20)19-35-16-8-15-30-25(32)18-31(36(33,34)24-13-3-2-4-14-24)23-12-7-11-22(17-23)26(27,28)29/h2-7,9-14,17H,8,15-16,18-19H2,1H3,(H,30,32) |
| InChIKey | YHTLGRXPPPKLRN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.64 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|