C24H21Cl2F3N2O3S2 — CID 126034952
2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 126034952) has the molecular formula C24H21Cl2F3N2O3S2 and a molecular weight of 577.48 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 126034952 |
| Molecular Formula | C24H21Cl2F3N2O3S2 |
| Molecular Weight | 577.48 g/mol |
| Exact Mass | 576.03 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | O=C(CN(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1ccccc1)NCCSCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H21Cl2F3N2O3S2/c25-21-10-5-11-22(26)20(21)16-35-13-12-30-23(32)15-31(36(33,34)19-8-2-1-3-9-19)18-7-4-6-17(14-18)24(27,28)29/h1-11,14H,12-13,15-16H2,(H,30,32) |
| InChIKey | OMYSFYQIWXDTAM-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.48 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|