C27H30ClFN2O6S2 — CID 43896531
2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)-N-[3-[(2-fluorophenyl)methylsulfanyl]propyl]acetamide (PubChem CID 43896531) has the molecular formula C27H30ClFN2O6S2 and a molecular weight of 597.13 g/mol. Its IUPAC name is 2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)-N-[3-[(2-fluorophenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)-N-[3-[(2-fluorophenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 43896531 |
| Molecular Formula | C27H30ClFN2O6S2 |
| Molecular Weight | 597.13 g/mol |
| Exact Mass | 596.12 |
| IUPAC Name | 2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)-N-[3-[(2-fluorophenyl)methylsulfanyl]propyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCCCSCc2ccccc2F)c2cc(Cl)ccc2OC)cc1OC |
| InChI | InChI=1S/C27H30ClFN2O6S2/c1-35-24-11-9-20(28)15-23(24)31(39(33,34)21-10-12-25(36-2)26(16-21)37-3)17-27(32)30-13-6-14-38-18-19-7-4-5-8-22(19)29/h4-5,7-12,15-16H,6,13-14,17-18H2,1-3H3,(H,30,32) |
| InChIKey | UNDWQHHYDLQABV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.13 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|