C25H26ClFN2O5S2 — CID 43901187
2-(3-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-(3-phenylsulfanylpropyl)acetamide (PubChem CID 43901187) has the molecular formula C25H26ClFN2O5S2 and a molecular weight of 553.08 g/mol. Its IUPAC name is 2-(3-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-(3-phenylsulfanylpropyl)acetamide.
| Compound Name | 2-(3-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-(3-phenylsulfanylpropyl)acetamide |
|---|---|
| PubChem CID | 43901187 |
| Molecular Formula | C25H26ClFN2O5S2 |
| Molecular Weight | 553.08 g/mol |
| Exact Mass | 552.10 |
| IUPAC Name | 2-(3-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-(3-phenylsulfanylpropyl)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCCCSc2ccccc2)c2ccc(F)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C25H26ClFN2O5S2/c1-33-23-12-10-20(16-24(23)34-2)36(31,32)29(18-9-11-22(27)21(26)15-18)17-25(30)28-13-6-14-35-19-7-4-3-5-8-19/h3-5,7-12,15-16H,6,13-14,17H2,1-2H3,(H,28,30) |
| InChIKey | JDSBELVPLYPGDN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.08 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|