C24H25ClN2O4S2 — CID 30206000
2-[N-(benzenesulfonyl)-5-chloro-2-methoxyanilino]-N-(3-phenylsulfanylpropyl)acetamide (PubChem CID 30206000) has the molecular formula C24H25ClN2O4S2 and a molecular weight of 505.06 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-5-chloro-2-methoxyanilino]-N-(3-phenylsulfanylpropyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-5-chloro-2-methoxyanilino]-N-(3-phenylsulfanylpropyl)acetamide |
|---|---|
| PubChem CID | 30206000 |
| Molecular Formula | C24H25ClN2O4S2 |
| Molecular Weight | 505.06 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-5-chloro-2-methoxyanilino]-N-(3-phenylsulfanylpropyl)acetamide |
| SMILES | COc1ccc(Cl)cc1N(CC(=O)NCCCSc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H25ClN2O4S2/c1-31-23-14-13-19(25)17-22(23)27(33(29,30)21-11-6-3-7-12-21)18-24(28)26-15-8-16-32-20-9-4-2-5-10-20/h2-7,9-14,17H,8,15-16,18H2,1H3,(H,26,28) |
| InChIKey | WURVMNYHPRWLEX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.06 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|